C25H48O3Si2 — CID 102028167
(3S,5S,8R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[4.5]dec-9-en-4-one (PubChem CID 102028167) has the molecular formula C25H48O3Si2 and a molecular weight of 452.83 g/mol. Its IUPAC name is (3S,5S,8R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[4.5]dec-9-en-4-one.
| Compound Name | (3S,5S,8R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[4.5]dec-9-en-4-one |
|---|---|
| PubChem CID | 102028167 |
| Molecular Formula | C25H48O3Si2 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (3S,5S,8R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[4.5]dec-9-en-4-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@]2(C=C[C@H](CO[Si](C)(C)C(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C25H48O3Si2/c1-19(28-30(10,11)24(5,6)7)21-14-17-25(22(21)26)15-12-20(13-16-25)18-27-29(8,9)23(2,3)4/h12,15,19-21H,13-14,16-18H2,1-11H3/t19-,20+,21+,25+/m1/s1 |
| InChIKey | IFPVGNCZWTUCJS-VWEIPLKFSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|