C19H34O2Si — CID 102523294
cis-(2S,3S)-2-[(1S,2R)-1-hydroxy-2-propan-2-ylpent-4-enyl]-3-(3-trimethylsilylprop-1-en-2-yl)cyclopentan-1-one (PubChem CID 102523294) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is cis-(2S,3S)-2-[(1S,2R)-1-hydroxy-2-propan-2-ylpent-4-enyl]-3-(3-trimethylsilylprop-1-en-2-yl)cyclopentan-1-one.
| Compound Name | cis-(2S,3S)-2-[(1S,2R)-1-hydroxy-2-propan-2-ylpent-4-enyl]-3-(3-trimethylsilylprop-1-en-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 102523294 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | cis-(2S,3S)-2-[(1S,2R)-1-hydroxy-2-propan-2-ylpent-4-enyl]-3-(3-trimethylsilylprop-1-en-2-yl)cyclopentan-1-one |
| SMILES | C=CC[C@H](C(C)C)[C@H](O)[C@H]1C(=O)CC[C@@H]1C(=C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-8-9-15(13(2)3)19(21)18-16(10-11-17(18)20)14(4)12-22(5,6)7/h8,13,15-16,18-19,21H,1,4,9-12H2,2-3,5-7H3/t15-,16-,18-,19+/m1/s1 |
| InChIKey | DUIRCPTWRALEHY-RWQQGDIJSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|