C24H44O3Si — CID 25112424
cis-(2R,3R)-3-but-3-enyl-2-[(1R,3S)-1-hydroxy-3-methyl-5-triethylsilyloxyhept-6-enyl]-3-methylcyclopentan-1-one (PubChem CID 25112424) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is cis-(2R,3R)-3-but-3-enyl-2-[(1R,3S)-1-hydroxy-3-methyl-5-triethylsilyloxyhept-6-enyl]-3-methylcyclopentan-1-one.
| Compound Name | cis-(2R,3R)-3-but-3-enyl-2-[(1R,3S)-1-hydroxy-3-methyl-5-triethylsilyloxyhept-6-enyl]-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 25112424 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | cis-(2R,3R)-3-but-3-enyl-2-[(1R,3S)-1-hydroxy-3-methyl-5-triethylsilyloxyhept-6-enyl]-3-methylcyclopentan-1-one |
| SMILES | C=CCC[C@]1(C)CCC(=O)[C@H]1[C@H](O)C[C@H](C)CC(C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H44O3Si/c1-8-13-15-24(7)16-14-21(25)23(24)22(26)18-19(6)17-20(9-2)27-28(10-3,11-4)12-5/h8-9,19-20,22-23,26H,1-2,10-18H2,3-7H3/t19-,20?,22-,23+,24-/m1/s1 |
| InChIKey | JKLUQRKSQXKAAY-WZIRNPQZSA-N |
| XLogP | 6.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|