C26H46O2Si — CID 134879361
1-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]propan-1-one (PubChem CID 134879361) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is 1-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]propan-1-one.
| Compound Name | 1-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]propan-1-one |
|---|---|
| PubChem CID | 134879361 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 1-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]propan-1-one |
| SMILES | CCC(=O)[C@@]1(C)[C@@H]2[C@@H](/C(C)=C/[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C)C(C)=C[C@@]21C |
| InChI | InChI=1S/C26H46O2Si/c1-13-20(28-29(11,12)24(6,7)8)17(3)15-18(4)22-19(5)16-25(9)23(22)26(25,10)21(27)14-2/h15-17,20,22-23H,13-14H2,1-12H3/b18-15+/t17-,20-,22+,23-,25+,26+/m1/s1 |
| InChIKey | SXSCMUUWNVONKV-JRRNGJFPSA-N |
| XLogP | 7.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|