C28H50O2Si — CID 57047876
(2R)-2-[7-[tert-butyl(dimethyl)silyl]oxyhepta-3,4-dienyl]-3-(4-methylnonyl)cyclopent-3-en-1-one (PubChem CID 57047876) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (2R)-2-[7-[tert-butyl(dimethyl)silyl]oxyhepta-3,4-dienyl]-3-(4-methylnonyl)cyclopent-3-en-1-one.
| Compound Name | (2R)-2-[7-[tert-butyl(dimethyl)silyl]oxyhepta-3,4-dienyl]-3-(4-methylnonyl)cyclopent-3-en-1-one |
|---|---|
| PubChem CID | 57047876 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (2R)-2-[7-[tert-butyl(dimethyl)silyl]oxyhepta-3,4-dienyl]-3-(4-methylnonyl)cyclopent-3-en-1-one |
| SMILES | CCCCCC(C)CCCC1=CCC(=O)[C@@H]1CCC=C=CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O2Si/c1-8-9-13-17-24(2)18-16-19-25-21-22-27(29)26(25)20-14-11-10-12-15-23-30-31(6,7)28(3,4)5/h11-12,21,24,26H,8-9,13-20,22-23H2,1-7H3/t10?,24?,26-/m1/s1 |
| InChIKey | AFUYTTLOPRABRQ-HJBVHAIGSA-N |
| XLogP | 8.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|