C19H34OSi — CID 102064415
3-(7-methyl-3-methylidene-1-trimethylsilyloct-6-en-2-yl)cyclohexan-1-one (PubChem CID 102064415) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is 3-(7-methyl-3-methylidene-1-trimethylsilyloct-6-en-2-yl)cyclohexan-1-one.
| Compound Name | 3-(7-methyl-3-methylidene-1-trimethylsilyloct-6-en-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 102064415 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 3-(7-methyl-3-methylidene-1-trimethylsilyloct-6-en-2-yl)cyclohexan-1-one |
| SMILES | C=C(CCC=C(C)C)C(C[Si](C)(C)C)C1CCCC(=O)C1 |
| InChI | InChI=1S/C19H34OSi/c1-15(2)9-7-10-16(3)19(14-21(4,5)6)17-11-8-12-18(20)13-17/h9,17,19H,3,7-8,10-14H2,1-2,4-6H3 |
| InChIKey | AONPXOGOSNOJNR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|