C29H52O2Si — CID 158769403
butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane;1-(2,6,6-trimethylcyclohex-2-en-1-yl)propan-2-one (PubChem CID 158769403) has the molecular formula C29H52O2Si and a molecular weight of 460.82 g/mol. Its IUPAC name is butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane;1-(2,6,6-trimethylcyclohex-2-en-1-yl)propan-2-one.
| Compound Name | butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane;1-(2,6,6-trimethylcyclohex-2-en-1-yl)propan-2-one |
|---|---|
| PubChem CID | 158769403 |
| Molecular Formula | C29H52O2Si |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane;1-(2,6,6-trimethylcyclohex-2-en-1-yl)propan-2-one |
| SMILES | C=C(C)C#CC(O[Si](C)(C)CCCC)C(C)CCC.CC(=O)CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H32OSi.C12H20O/c1-8-10-14-19(6,7)18-17(13-12-15(3)4)16(5)11-9-2;1-9-6-5-7-12(3,4)11(9)8-10(2)13/h16-17H,3,8-11,14H2,1-2,4-7H3;6,11H,5,7-8H2,1-4H3 |
| InChIKey | IPRFYCVVINQICV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|