C29H44O2Si — CID 102106184
2-[6-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpent-4-en-2-yl)dec-9-en-1,4-diynyl]cyclohexene-1-carbaldehyde (PubChem CID 102106184) has the molecular formula C29H44O2Si and a molecular weight of 452.76 g/mol. Its IUPAC name is 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpent-4-en-2-yl)dec-9-en-1,4-diynyl]cyclohexene-1-carbaldehyde.
| Compound Name | 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpent-4-en-2-yl)dec-9-en-1,4-diynyl]cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 102106184 |
| Molecular Formula | C29H44O2Si |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-(2-methylpent-4-en-2-yl)dec-9-en-1,4-diynyl]cyclohexene-1-carbaldehyde |
| SMILES | C=CCCC(C#CC(C#CC1=C(C=O)CCCC1)C(C)(C)CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44O2Si/c1-10-12-17-27(31-32(8,9)28(3,4)5)21-20-26(29(6,7)22-11-2)19-18-24-15-13-14-16-25(24)23-30/h10-11,23,26-27H,1-2,12-17,22H2,3-9H3 |
| InChIKey | UUHXZTJZCCIFAQ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|