C20H34OSi — CID 11415902
trans-(3R,4R)-3,4-dimethyl-3-[(E)-3-methyl-8-trimethylsilyloct-3-en-7-ynyl]cyclohexan-1-one (PubChem CID 11415902) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is trans-(3R,4R)-3,4-dimethyl-3-[(E)-3-methyl-8-trimethylsilyloct-3-en-7-ynyl]cyclohexan-1-one.
| Compound Name | trans-(3R,4R)-3,4-dimethyl-3-[(E)-3-methyl-8-trimethylsilyloct-3-en-7-ynyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11415902 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | trans-(3R,4R)-3,4-dimethyl-3-[(E)-3-methyl-8-trimethylsilyloct-3-en-7-ynyl]cyclohexan-1-one |
| SMILES | C/C(=C\CCC#C[Si](C)(C)C)CC[C@]1(C)CC(=O)CC[C@H]1C |
| InChI | InChI=1S/C20H34OSi/c1-17(10-8-7-9-15-22(4,5)6)13-14-20(3)16-19(21)12-11-18(20)2/h10,18H,7-8,11-14,16H2,1-6H3/b17-10+/t18-,20-/m1/s1 |
| InChIKey | BXXBRRFUBZZBNJ-YLBLARDPSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|