C15H28OSi — CID 132553387
trans-(2S,3R)-2,3-dimethyl-2-[(E)-3-trimethylsilylbut-2-enyl]cyclohexan-1-one (PubChem CID 132553387) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is trans-(2S,3R)-2,3-dimethyl-2-[(E)-3-trimethylsilylbut-2-enyl]cyclohexan-1-one.
| Compound Name | trans-(2S,3R)-2,3-dimethyl-2-[(E)-3-trimethylsilylbut-2-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 132553387 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | trans-(2S,3R)-2,3-dimethyl-2-[(E)-3-trimethylsilylbut-2-enyl]cyclohexan-1-one |
| SMILES | C/C(=C\C[C@]1(C)C(=O)CCC[C@H]1C)[Si](C)(C)C |
| InChI | InChI=1S/C15H28OSi/c1-12-8-7-9-14(16)15(12,3)11-10-13(2)17(4,5)6/h10,12H,7-9,11H2,1-6H3/b13-10+/t12-,15+/m1/s1 |
| InChIKey | OZTOEXHHJSOPJG-RYGRJTBMSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|