C14H24O — CID 14489320
4-[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]butan-2-one (PubChem CID 14489320) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 4-[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]butan-2-one.
| Compound Name | 4-[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]butan-2-one |
|---|---|
| PubChem CID | 14489320 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 4-[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1C(C)=CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C14H24O/c1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15/h6,11,13H,7-9H2,1-5H3/t11-,13-/m1/s1 |
| InChIKey | GOWGYNUJGXNVOU-DGCLKSJQSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|