C20H38O2Si — CID 11078283
trans-(2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-2-enyl]-2,3-dimethylcyclohexan-1-one (PubChem CID 11078283) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is trans-(2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-2-enyl]-2,3-dimethylcyclohexan-1-one.
| Compound Name | trans-(2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-2-enyl]-2,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 11078283 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | trans-(2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-2-enyl]-2,3-dimethylcyclohexan-1-one |
| SMILES | C/C(=C\C[C@]1(C)C(=O)CCC[C@H]1C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-16(13-15-22-23(7,8)19(3,4)5)12-14-20(6)17(2)10-9-11-18(20)21/h12,17H,9-11,13-15H2,1-8H3/b16-12+/t17-,20+/m1/s1 |
| InChIKey | COSFMLOPIARUEZ-IZUCHYEISA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|