C15H24O4Si — CID 14911452
dimethyl (3E,4E)-3-ethylidene-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 14911452) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is dimethyl (3E,4E)-3-ethylidene-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,4E)-3-ethylidene-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 14911452 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | dimethyl (3E,4E)-3-ethylidene-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C/C=C1\CC(C(=O)OC)(C(=O)OC)C\C1=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H24O4Si/c1-7-11-8-15(13(16)18-2,14(17)19-3)9-12(11)10-20(4,5)6/h7,10H,8-9H2,1-6H3/b11-7+,12-10+ |
| InChIKey | KDFRQRRVHACRQZ-CRALUGIISA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|