C26H48O4SiSn — CID 11786432
dimethyl (3Z,4Z)-3-(tributylstannylmethylidene)-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 11786432) has the molecular formula C26H48O4SiSn and a molecular weight of 571.46 g/mol. Its IUPAC name is dimethyl (3Z,4Z)-3-(tributylstannylmethylidene)-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z,4Z)-3-(tributylstannylmethylidene)-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11786432 |
| Molecular Formula | C26H48O4SiSn |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | dimethyl (3Z,4Z)-3-(tributylstannylmethylidene)-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCC[Sn](/C=C1/CC(C(=O)OC)(C(=O)OC)C/C1=C/[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C14H21O4Si.3C4H9.Sn/c1-10-7-14(12(15)17-2,13(16)18-3)8-11(10)9-19(4,5)6;3*1-3-4-2;/h1,9H,7-8H2,2-6H3;3*1,3-4H2,2H3;/b10-1?,11-9-;;;; |
| InChIKey | VVNSHXUIIMTFMA-CEXPOERHSA-N |
| XLogP | 7.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|