C23H40O4Sn — CID 10696681
dimethyl (4Z)-3-methylidene-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10696681) has the molecular formula C23H40O4Sn and a molecular weight of 499.28 g/mol. Its IUPAC name is dimethyl (4Z)-3-methylidene-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4Z)-3-methylidene-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10696681 |
| Molecular Formula | C23H40O4Sn |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | dimethyl (4Z)-3-methylidene-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C/C1=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H13O4.3C4H9.Sn/c1-7-5-11(6-8(7)2,9(12)14-3)10(13)15-4;3*1-3-4-2;/h1H,2,5-6H2,3-4H3;3*1,3-4H2,2H3; |
| InChIKey | GAWXPKOBPODMCW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|