C26H50O3SiSn — CID 15083410
ethyl 2-oxo-1-[(Z)-2-tributylstannyl-3-trimethylsilylprop-2-enyl]cyclopentane-1-carboxylate (PubChem CID 15083410) has the molecular formula C26H50O3SiSn and a molecular weight of 557.48 g/mol. Its IUPAC name is ethyl 2-oxo-1-[(Z)-2-tributylstannyl-3-trimethylsilylprop-2-enyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-oxo-1-[(Z)-2-tributylstannyl-3-trimethylsilylprop-2-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 15083410 |
| Molecular Formula | C26H50O3SiSn |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | ethyl 2-oxo-1-[(Z)-2-tributylstannyl-3-trimethylsilylprop-2-enyl]cyclopentane-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\[Si](C)(C)C)CC1(C(=O)OCC)CCCC1=O |
| InChI | InChI=1S/C14H23O3Si.3C4H9.Sn/c1-5-17-13(16)14(9-6-8-12(14)15)10-7-11-18(2,3)4;3*1-3-4-2;/h11H,5-6,8-10H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | IIOQJIYAJOMZRJ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|