C30H56O4SiSn — CID 11377122
trans-diethyl (3R,4R)-3-(1-tributylstannylethenyl)-4-(1-trimethylsilylethenyl)cyclopentane-1,1-dicarboxylate (PubChem CID 11377122) has the molecular formula C30H56O4SiSn and a molecular weight of 627.57 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-(1-tributylstannylethenyl)-4-(1-trimethylsilylethenyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-(1-tributylstannylethenyl)-4-(1-trimethylsilylethenyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11377122 |
| Molecular Formula | C30H56O4SiSn |
| Molecular Weight | 627.57 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | trans-diethyl (3R,4R)-3-(1-tributylstannylethenyl)-4-(1-trimethylsilylethenyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C([C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1C(=C)[Sn](CCCC)(CCCC)CCCC)[Si](C)(C)C |
| InChI | InChI=1S/C18H29O4Si.3C4H9.Sn/c1-8-14-11-18(16(19)21-9-2,17(20)22-10-3)12-15(14)13(4)23(5,6)7;3*1-3-4-2;/h14-15H,1,4,9-12H2,2-3,5-7H3;3*1,3-4H2,2H3;/t14-,15+;;;;/m1..../s1 |
| InChIKey | RUKOCVHHQRVMSB-ADTSQVCLSA-N |
| XLogP | 8.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.57 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|