C39H74GeO4Sn — CID 134998675
cis-diethyl (3S,4R)-3-(1-tributylgermylethenyl)-4-(1-tributylstannylethenyl)cyclopentane-1,1-dicarboxylate (PubChem CID 134998675) has the molecular formula C39H74GeO4Sn and a molecular weight of 798.34 g/mol. Its IUPAC name is cis-diethyl (3S,4R)-3-(1-tributylgermylethenyl)-4-(1-tributylstannylethenyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3S,4R)-3-(1-tributylgermylethenyl)-4-(1-tributylstannylethenyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134998675 |
| Molecular Formula | C39H74GeO4Sn |
| Molecular Weight | 798.34 g/mol |
| Exact Mass | 800.38 |
| IUPAC Name | cis-diethyl (3S,4R)-3-(1-tributylgermylethenyl)-4-(1-tributylstannylethenyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C([C@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1C(=C)[Sn](CCCC)(CCCC)CCCC)[Ge](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C27H47GeO4.3C4H9.Sn/c1-8-14-17-28(18-15-9-2,19-16-10-3)22(7)24-21-27(20-23(24)11-4,25(29)31-12-5)26(30)32-13-6;3*1-3-4-2;/h23-24H,4,7-10,12-21H2,1-3,5-6H3;3*1,3-4H2,2H3;/t23-,24-;;;;/m1..../s1 |
| InChIKey | FLQQWZCUORYPCC-PIJQHSLXSA-N |
| XLogP | 12.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.34 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|