C22H34O6 — CID 134947952
trans-diethyl (3R,4R)-3-(2-methoxy-2-oxoethyl)-4-(3-methylidenehept-1-en-2-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 134947952) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-(2-methoxy-2-oxoethyl)-4-(3-methylidenehept-1-en-2-yl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-(2-methoxy-2-oxoethyl)-4-(3-methylidenehept-1-en-2-yl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134947952 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | trans-diethyl (3R,4R)-3-(2-methoxy-2-oxoethyl)-4-(3-methylidenehept-1-en-2-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(CCCC)C(=C)[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C22H34O6/c1-7-10-11-15(4)16(5)18-14-22(20(24)27-8-2,21(25)28-9-3)13-17(18)12-19(23)26-6/h17-18H,4-5,7-14H2,1-3,6H3/t17-,18-/m0/s1 |
| InChIKey | SHZCSUGKCAXHAX-ROUUACIJSA-N |
| XLogP | 3.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|