C19H32O4Se — CID 15733855
diethyl (3E)-3-(butylselanylmethylidene)-4-propan-2-ylcyclopentane-1,1-dicarboxylate (PubChem CID 15733855) has the molecular formula C19H32O4Se and a molecular weight of 403.42 g/mol. Its IUPAC name is diethyl (3E)-3-(butylselanylmethylidene)-4-propan-2-ylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (3E)-3-(butylselanylmethylidene)-4-propan-2-ylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15733855 |
| Molecular Formula | C19H32O4Se |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | diethyl (3E)-3-(butylselanylmethylidene)-4-propan-2-ylcyclopentane-1,1-dicarboxylate |
| SMILES | CCCC[Se]/C=C1\CC(C(=O)OCC)(C(=O)OCC)CC1C(C)C |
| InChI | InChI=1S/C19H32O4Se/c1-6-9-10-24-13-15-11-19(17(20)22-7-2,18(21)23-8-3)12-16(15)14(4)5/h13-14,16H,6-12H2,1-5H3/b15-13+ |
| InChIKey | OLZQTRZIWBWIGH-FYWRMAATSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|