C16H26O4 — CID 138965404
diethyl (4S)-3,3-dimethyl-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate (PubChem CID 138965404) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is diethyl (4S)-3,3-dimethyl-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (4S)-3,3-dimethyl-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 138965404 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | diethyl (4S)-3,3-dimethyl-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C)[C@@H]1CC(C(=O)OCC)(C(=O)OCC)CC1(C)C |
| InChI | InChI=1S/C16H26O4/c1-7-19-13(17)16(14(18)20-8-2)9-12(11(3)4)15(5,6)10-16/h12H,3,7-10H2,1-2,4-6H3/t12-/m0/s1 |
| InChIKey | AUOLBFHAEVMRAM-LBPRGKRZSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|