C18H32O4Si — CID 164685473
cis-diethyl (2S,5S)-2-methyl-5-(3-trimethylsilylprop-1-en-2-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 164685473) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is cis-diethyl (2S,5S)-2-methyl-5-(3-trimethylsilylprop-1-en-2-yl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (2S,5S)-2-methyl-5-(3-trimethylsilylprop-1-en-2-yl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164685473 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | cis-diethyl (2S,5S)-2-methyl-5-(3-trimethylsilylprop-1-en-2-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C[Si](C)(C)C)[C@H]1CC[C@H](C)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H32O4Si/c1-8-21-16(19)18(17(20)22-9-2)14(4)10-11-15(18)13(3)12-23(5,6)7/h14-15H,3,8-12H2,1-2,4-7H3/t14-,15+/m0/s1 |
| InChIKey | YPNHXAMVHWSKFD-LSDHHAIUSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|