C20H34O2Si — CID 134949863
ethyl 2-[(1R,3S)-1,4,4-trimethyl-2-methylidene-3-(4-trimethylsilylbut-3-ynyl)cyclopentyl]acetate (PubChem CID 134949863) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-1,4,4-trimethyl-2-methylidene-3-(4-trimethylsilylbut-3-ynyl)cyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,3S)-1,4,4-trimethyl-2-methylidene-3-(4-trimethylsilylbut-3-ynyl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 134949863 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | ethyl 2-[(1R,3S)-1,4,4-trimethyl-2-methylidene-3-(4-trimethylsilylbut-3-ynyl)cyclopentyl]acetate |
| SMILES | C=C1[C@@H](CCC#C[Si](C)(C)C)C(C)(C)C[C@]1(C)CC(=O)OCC |
| InChI | InChI=1S/C20H34O2Si/c1-9-22-18(21)14-20(5)15-19(3,4)17(16(20)2)12-10-11-13-23(6,7)8/h17H,2,9-10,12,14-15H2,1,3-8H3/t17-,20+/m1/s1 |
| InChIKey | VHILHMDDLVMGNJ-XLIONFOSSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|