C19H30O3Si — CID 11067633
ethyl 3-but-3-enyl-2-oxo-3-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate (PubChem CID 11067633) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is ethyl 3-but-3-enyl-2-oxo-3-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-but-3-enyl-2-oxo-3-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11067633 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | ethyl 3-but-3-enyl-2-oxo-3-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate |
| SMILES | C=CCCC1(CCC#C[Si](C)(C)C)CCC(C(=O)OCC)C1=O |
| InChI | InChI=1S/C19H30O3Si/c1-6-8-12-19(13-9-10-15-23(3,4)5)14-11-16(17(19)20)18(21)22-7-2/h6,16H,1,7-9,11-14H2,2-5H3 |
| InChIKey | CLIPOHBBMGYLTJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|