C16H24O3Si — CID 11551050
ethyl 3-methylidene-1-(3-trimethylsilylprop-2-ynoyl)cyclohexane-1-carboxylate (PubChem CID 11551050) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is ethyl 3-methylidene-1-(3-trimethylsilylprop-2-ynoyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 3-methylidene-1-(3-trimethylsilylprop-2-ynoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11551050 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | ethyl 3-methylidene-1-(3-trimethylsilylprop-2-ynoyl)cyclohexane-1-carboxylate |
| SMILES | C=C1CCCC(C(=O)C#C[Si](C)(C)C)(C(=O)OCC)C1 |
| InChI | InChI=1S/C16H24O3Si/c1-6-19-15(18)16(10-7-8-13(2)12-16)14(17)9-11-20(3,4)5/h2,6-8,10,12H2,1,3-5H3 |
| InChIKey | VEQWFHOPSGIJAS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|