C18H28O3Si — CID 155931124
ethyl (1R)-2-oxo-6-prop-1-en-2-yl-1-(3-trimethylsilylprop-2-ynyl)cyclohexane-1-carboxylate (PubChem CID 155931124) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is ethyl (1R)-2-oxo-6-prop-1-en-2-yl-1-(3-trimethylsilylprop-2-ynyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1R)-2-oxo-6-prop-1-en-2-yl-1-(3-trimethylsilylprop-2-ynyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155931124 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl (1R)-2-oxo-6-prop-1-en-2-yl-1-(3-trimethylsilylprop-2-ynyl)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C1CCCC(=O)[C@]1(CC#C[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H28O3Si/c1-7-21-17(20)18(12-9-13-22(4,5)6)15(14(2)3)10-8-11-16(18)19/h15H,2,7-8,10-12H2,1,3-6H3/t15?,18-/m1/s1 |
| InChIKey | AFBGNKDALHARGJ-KPMSDPLLSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|