C24H40O4Si — CID 101476252
diethyl 3-methylidene-4-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentane-1,1-dicarboxylate (PubChem CID 101476252) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is diethyl 3-methylidene-4-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-methylidene-4-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101476252 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | diethyl 3-methylidene-4-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40O4Si/c1-10-27-22(25)24(23(26)28-11-2)15-20(9)21(16-24)13-12-14-29(17(3)4,18(5)6)19(7)8/h17-19,21H,9-11,13,15-16H2,1-8H3 |
| InChIKey | XDEMZKUHKYDRHQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|