C19H32O4Si — CID 10871890
dimethyl (3E)-2,2-dimethyl-4-methylidene-3-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10871890) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is dimethyl (3E)-2,2-dimethyl-4-methylidene-3-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E)-2,2-dimethyl-4-methylidene-3-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10871890 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | dimethyl (3E)-2,2-dimethyl-4-methylidene-3-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C(C)(C)/C1=C/[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H32O4Si/c1-9-24(10-2,11-3)13-15-14(4)12-19(16(20)22-7,17(21)23-8)18(15,5)6/h13H,4,9-12H2,1-3,5-8H3/b15-13+ |
| InChIKey | GLLJXWOMWXIYRR-FYWRMAATSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|