C16H26O6Si — CID 46866730
2-O-ethyl 1-O,1-O'-dimethyl (3E)-3-(trimethylsilylmethylidene)cyclopentane-1,1,2-tricarboxylate (PubChem CID 46866730) has the molecular formula C16H26O6Si and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-O-ethyl 1-O,1-O'-dimethyl (3E)-3-(trimethylsilylmethylidene)cyclopentane-1,1,2-tricarboxylate.
| Compound Name | 2-O-ethyl 1-O,1-O'-dimethyl (3E)-3-(trimethylsilylmethylidene)cyclopentane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 46866730 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-O-ethyl 1-O,1-O'-dimethyl (3E)-3-(trimethylsilylmethylidene)cyclopentane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C1/C(=C/[Si](C)(C)C)CCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H26O6Si/c1-7-22-13(17)12-11(10-23(4,5)6)8-9-16(12,14(18)20-2)15(19)21-3/h10,12H,7-9H2,1-6H3/b11-10+ |
| InChIKey | XVASXFDFYDNADU-ZHACJKMWSA-N |
| XLogP | 2.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|