C17H30O4Si — CID 5366458
diethyl (4E)-3,3-dimethyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate (PubChem CID 5366458) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is diethyl (4E)-3,3-dimethyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate.
| Compound Name | diethyl (4E)-3,3-dimethyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 5366458 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | diethyl (4E)-3,3-dimethyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1C/C(=C\[Si](C)(C)C)C(C)(C)C1C(=O)OCC |
| InChI | InChI=1S/C17H30O4Si/c1-8-20-15(18)13-10-12(11-22(5,6)7)17(3,4)14(13)16(19)21-9-2/h11,13-14H,8-10H2,1-7H3/b12-11+ |
| InChIKey | RCLHQUUFRXAVPL-VAWYXSNFSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|