C14H20O4 — CID 135072015
diethyl (4S,5S)-7-methylidenespiro[2.4]heptane-4,5-dicarboxylate (PubChem CID 135072015) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is diethyl (4S,5S)-7-methylidenespiro[2.4]heptane-4,5-dicarboxylate.
| Compound Name | diethyl (4S,5S)-7-methylidenespiro[2.4]heptane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 135072015 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | diethyl (4S,5S)-7-methylidenespiro[2.4]heptane-4,5-dicarboxylate |
| SMILES | C=C1C[C@H](C(=O)OCC)[C@H](C(=O)OCC)C12CC2 |
| InChI | InChI=1S/C14H20O4/c1-4-17-12(15)10-8-9(3)14(6-7-14)11(10)13(16)18-5-2/h10-11H,3-8H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | BWVJNCCUQCYKRY-WDEREUQCSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|