C14H24O3Si — CID 10978484
trans-methyl (1R,5R)-1-acetyl-2-methylidene-5-(trimethylsilylmethyl)cyclopentane-1-carboxylate (PubChem CID 10978484) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is trans-methyl (1R,5R)-1-acetyl-2-methylidene-5-(trimethylsilylmethyl)cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,5R)-1-acetyl-2-methylidene-5-(trimethylsilylmethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10978484 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | trans-methyl (1R,5R)-1-acetyl-2-methylidene-5-(trimethylsilylmethyl)cyclopentane-1-carboxylate |
| SMILES | C=C1CC[C@@H](C[Si](C)(C)C)[C@@]1(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C14H24O3Si/c1-10-7-8-12(9-18(4,5)6)14(10,11(2)15)13(16)17-3/h12H,1,7-9H2,2-6H3/t12-,14+/m0/s1 |
| InChIKey | ZTMDVCHUZVPBRR-GXTWGEPZSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|