C13H20O3 — CID 138982934
cis-methyl (1R,2R)-2-methyl-1-(3-methylbut-3-enyl)-5-oxocyclopentane-1-carboxylate (PubChem CID 138982934) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-methyl-1-(3-methylbut-3-enyl)-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-methyl-1-(3-methylbut-3-enyl)-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 138982934 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | cis-methyl (1R,2R)-2-methyl-1-(3-methylbut-3-enyl)-5-oxocyclopentane-1-carboxylate |
| SMILES | C=C(C)CC[C@]1(C(=O)OC)C(=O)CC[C@H]1C |
| InChI | InChI=1S/C13H20O3/c1-9(2)7-8-13(12(15)16-4)10(3)5-6-11(13)14/h10H,1,5-8H2,2-4H3/t10-,13-/m1/s1 |
| InChIKey | ZGLHARWFGKYZMQ-ZWNOBZJWSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|