C16H28O4Si — CID 5366456
diethyl (4E)-3-methyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate (PubChem CID 5366456) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is diethyl (4E)-3-methyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate.
| Compound Name | diethyl (4E)-3-methyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 5366456 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | diethyl (4E)-3-methyl-4-(trimethylsilylmethylidene)cyclopentane-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1C/C(=C\[Si](C)(C)C)C(C)C1C(=O)OCC |
| InChI | InChI=1S/C16H28O4Si/c1-7-19-15(17)13-9-12(10-21(4,5)6)11(3)14(13)16(18)20-8-2/h10-11,13-14H,7-9H2,1-6H3/b12-10+ |
| InChIKey | LRWYUZMSKMPRLI-ZRDIBKRKSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|