C22H36O5Si — CID 11223559
diethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 11223559) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is diethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11223559 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | diethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | C=C1CC(CO[Si](C)(C)C(C)(C)C)=C2CC(C(=O)OCC)(C(=O)OCC)CC12 |
| InChI | InChI=1S/C22H36O5Si/c1-9-25-19(23)22(20(24)26-10-2)12-17-15(3)11-16(18(17)13-22)14-27-28(7,8)21(4,5)6/h17H,3,9-14H2,1-2,4-8H3 |
| InChIKey | ODVIQGGFDWJXPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|