C20H32O4Si — CID 135069887
diethyl (3S,3aR)-3-methyl-8-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 135069887) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is diethyl (3S,3aR)-3-methyl-8-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | diethyl (3S,3aR)-3-methyl-8-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135069887 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | diethyl (3S,3aR)-3-methyl-8-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C([Si](C)(C)C)CCC=C[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C20H32O4Si/c1-7-23-18(21)20(19(22)24-8-2)13-16-15(14(20)3)11-9-10-12-17(16)25(4,5)6/h9,11,14-15H,7-8,10,12-13H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | LTDKDOIPOUCZIV-LSDHHAIUSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|