C21H30O4Si — CID 102095716
diethyl (3Z)-3-(3-trimethylsilylprop-2-ynylidene)-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate (PubChem CID 102095716) has the molecular formula C21H30O4Si and a molecular weight of 374.55 g/mol. Its IUPAC name is diethyl (3Z)-3-(3-trimethylsilylprop-2-ynylidene)-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | diethyl (3Z)-3-(3-trimethylsilylprop-2-ynylidene)-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102095716 |
| Molecular Formula | C21H30O4Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | diethyl (3Z)-3-(3-trimethylsilylprop-2-ynylidene)-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C/C(=C/C#C[Si](C)(C)C)C2C=CCCC21 |
| InChI | InChI=1S/C21H30O4Si/c1-6-24-19(22)21(20(23)25-7-2)15-16(11-10-14-26(3,4)5)17-12-8-9-13-18(17)21/h8,11-12,17-18H,6-7,9,13,15H2,1-5H3/b16-11- |
| InChIKey | BZNFIDWDEWGHBJ-WJDWOHSUSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|