C16H20O6 — CID 13444344
trimethyl (3aS,6S,7aR)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1,6-tricarboxylate (PubChem CID 13444344) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is trimethyl (3aS,6S,7aR)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1,6-tricarboxylate.
| Compound Name | trimethyl (3aS,6S,7aR)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 13444344 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | trimethyl (3aS,6S,7aR)-3-methylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1,6-tricarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)[C@@H]2C[C@H](C(=O)OC)C=C[C@H]12 |
| InChI | InChI=1S/C16H20O6/c1-9-8-16(14(18)21-3,15(19)22-4)12-7-10(13(17)20-2)5-6-11(9)12/h5-6,10-12H,1,7-8H2,2-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | RUTULWWVMQNOLR-IJLUTSLNSA-N |
| XLogP | 1.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|