C20H30O4 — CID 15327124
trans-diethyl (3R,4R)-3-[(1E)-4-methylpenta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate (PubChem CID 15327124) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-[(1E)-4-methylpenta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-[(1E)-4-methylpenta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15327124 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | trans-diethyl (3R,4R)-3-[(1E)-4-methylpenta-1,3-dienyl]-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
| SMILES | C=CC[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1/C=C/C=C(C)C |
| InChI | InChI=1S/C20H30O4/c1-6-10-16-13-20(18(21)23-7-2,19(22)24-8-3)14-17(16)12-9-11-15(4)5/h6,9,11-12,16-17H,1,7-8,10,13-14H2,2-5H3/b12-9+/t16-,17-/m1/s1 |
| InChIKey | KGBJEBVMNCQOSR-MIJBNRBISA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|