C20H38O3Si — CID 101400105
trans-methyl (1S,2R)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 101400105) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is trans-methyl (1S,2R)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1S,2R)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101400105 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | trans-methyl (1S,2R)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@H]1CCC[C@@]1(CCCCO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C20H38O3Si/c1-16(2)17-12-11-14-20(17,18(21)22-6)13-9-10-15-23-24(7,8)19(3,4)5/h17H,1,9-15H2,2-8H3/t17-,20-/m1/s1 |
| InChIKey | UNJLTHKHPPXKDC-YLJYHZDGSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|