C16H28O2Si — CID 51349762
methyl 2-[(1S,3S)-2,2-dimethyl-3-(4-trimethylsilylbuta-2,3-dien-2-yl)cyclobutyl]acetate (PubChem CID 51349762) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is methyl 2-[(1S,3S)-2,2-dimethyl-3-(4-trimethylsilylbuta-2,3-dien-2-yl)cyclobutyl]acetate.
| Compound Name | methyl 2-[(1S,3S)-2,2-dimethyl-3-(4-trimethylsilylbuta-2,3-dien-2-yl)cyclobutyl]acetate |
|---|---|
| PubChem CID | 51349762 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | methyl 2-[(1S,3S)-2,2-dimethyl-3-(4-trimethylsilylbuta-2,3-dien-2-yl)cyclobutyl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](C(C)=C=C[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-12(8-9-19(5,6)7)14-10-13(16(14,2)3)11-15(17)18-4/h9,13-14H,10-11H2,1-7H3/t8?,13-,14+/m0/s1 |
| InChIKey | CHTSNGHMLFBJMO-AZGGKPGBSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|