C25H50O3Si2 — CID 164685085
methyl (2R)-5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate (PubChem CID 164685085) has the molecular formula C25H50O3Si2 and a molecular weight of 454.84 g/mol. Its IUPAC name is methyl (2R)-5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate.
| Compound Name | methyl (2R)-5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate |
|---|---|
| PubChem CID | 164685085 |
| Molecular Formula | C25H50O3Si2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | methyl (2R)-5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate |
| SMILES | CCC(=C=C[Si](C)(C)C)CC[C@](C)(CCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OC |
| InChI | InChI=1S/C25H50O3Si2/c1-13-23(15-19-29(10,11)12)14-16-25(8,24(26)27-9)17-18-28-30(20(2)3,21(4)5)22(6)7/h19-22H,13-14,16-18H2,1-12H3/t15?,25-/m1/s1 |
| InChIKey | UMKRATWWQIWRSN-FFMAFDDDSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|