C28H46O5Si — CID 177386527
diethyl 2-(4-methylpent-4-en-2-ynyl)-2-[(2E)-2-[tri(propan-2-yl)silyloxymethylidene]cyclopentyl]propanedioate (PubChem CID 177386527) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is diethyl 2-(4-methylpent-4-en-2-ynyl)-2-[(2E)-2-[tri(propan-2-yl)silyloxymethylidene]cyclopentyl]propanedioate.
| Compound Name | diethyl 2-(4-methylpent-4-en-2-ynyl)-2-[(2E)-2-[tri(propan-2-yl)silyloxymethylidene]cyclopentyl]propanedioate |
|---|---|
| PubChem CID | 177386527 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | diethyl 2-(4-methylpent-4-en-2-ynyl)-2-[(2E)-2-[tri(propan-2-yl)silyloxymethylidene]cyclopentyl]propanedioate |
| SMILES | C=C(C)C#CCC(C(=O)OCC)(C(=O)OCC)C1CCC/C1=C\O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H46O5Si/c1-11-31-26(29)28(27(30)32-12-2,18-14-15-20(3)4)25-17-13-16-24(25)19-33-34(21(5)6,22(7)8)23(9)10/h19,21-23,25H,3,11-13,16-18H2,1-2,4-10H3/b24-19+ |
| InChIKey | CDVHGFNRHFPZCV-LYBHJNIJSA-N |
| XLogP | 6.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|