C19H30O4Si — CID 134947378
diethyl 2-[(4S)-9-trimethylsilylnona-1,2-dien-8-yn-4-yl]propanedioate (PubChem CID 134947378) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is diethyl 2-[(4S)-9-trimethylsilylnona-1,2-dien-8-yn-4-yl]propanedioate.
| Compound Name | diethyl 2-[(4S)-9-trimethylsilylnona-1,2-dien-8-yn-4-yl]propanedioate |
|---|---|
| PubChem CID | 134947378 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | diethyl 2-[(4S)-9-trimethylsilylnona-1,2-dien-8-yn-4-yl]propanedioate |
| SMILES | C=C=C[C@H](CCCC#C[Si](C)(C)C)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H30O4Si/c1-7-13-16(14-11-10-12-15-24(4,5)6)17(18(20)22-8-2)19(21)23-9-3/h13,16-17H,1,8-11,14H2,2-6H3/t16-/m1/s1 |
| InChIKey | GMJUUDVMSDIFJP-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|