C28H50O4Si2 — CID 102384091
diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)-7-tri(propan-2-yl)silylhept-6-yn-2-yl]propanedioate (PubChem CID 102384091) has the molecular formula C28H50O4Si2 and a molecular weight of 506.88 g/mol. Its IUPAC name is diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)-7-tri(propan-2-yl)silylhept-6-yn-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)-7-tri(propan-2-yl)silylhept-6-yn-2-yl]propanedioate |
|---|---|
| PubChem CID | 102384091 |
| Molecular Formula | C28H50O4Si2 |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)-7-tri(propan-2-yl)silylhept-6-yn-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C)[C@H](C#C[Si](C)(C)C)CCC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H50O4Si2/c1-13-31-27(29)26(28(30)32-14-2)24(9)25(18-20-33(10,11)12)17-15-16-19-34(21(3)4,22(5)6)23(7)8/h21-26H,13-15,17H2,1-12H3/t24-,25-/m0/s1 |
| InChIKey | SWJVNRVSERWBMI-DQEYMECFSA-N |
| XLogP | 6.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|