C22H44O5Si — CID 86586487
ditert-butyl 2-[5-[tert-butyl(dimethyl)silyl]oxypentyl]propanedioate (PubChem CID 86586487) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is ditert-butyl 2-[5-[tert-butyl(dimethyl)silyl]oxypentyl]propanedioate.
| Compound Name | ditert-butyl 2-[5-[tert-butyl(dimethyl)silyl]oxypentyl]propanedioate |
|---|---|
| PubChem CID | 86586487 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | ditert-butyl 2-[5-[tert-butyl(dimethyl)silyl]oxypentyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCCCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H44O5Si/c1-20(2,3)26-18(23)17(19(24)27-21(4,5)6)15-13-12-14-16-25-28(10,11)22(7,8)9/h17H,12-16H2,1-11H3 |
| InChIKey | TUPHQPWILNUOON-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|