C19H38O4Si — CID 134969676
[(3R,4S,5R)-2,4-dimethyl-7-oxo-3-triethylsilyloxynonan-5-yl] acetate (PubChem CID 134969676) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is [(3R,4S,5R)-2,4-dimethyl-7-oxo-3-triethylsilyloxynonan-5-yl] acetate.
| Compound Name | [(3R,4S,5R)-2,4-dimethyl-7-oxo-3-triethylsilyloxynonan-5-yl] acetate |
|---|---|
| PubChem CID | 134969676 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [(3R,4S,5R)-2,4-dimethyl-7-oxo-3-triethylsilyloxynonan-5-yl] acetate |
| SMILES | CCC(=O)C[C@@H](OC(C)=O)[C@H](C)[C@H](O[Si](CC)(CC)CC)C(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-9-17(21)13-18(22-16(8)20)15(7)19(14(5)6)23-24(10-2,11-3)12-4/h14-15,18-19H,9-13H2,1-8H3/t15-,18+,19+/m0/s1 |
| InChIKey | KNPLNVKSXWSIHW-KFKAGJAMSA-N |
| XLogP | 4.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|