C26H52O3Si2 — CID 10504502
(3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]-3-hexyl-3-trimethylsilyloxetan-2-one (PubChem CID 10504502) has the molecular formula C26H52O3Si2 and a molecular weight of 468.87 g/mol. Its IUPAC name is (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]-3-hexyl-3-trimethylsilyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]-3-hexyl-3-trimethylsilyloxetan-2-one |
|---|---|
| PubChem CID | 10504502 |
| Molecular Formula | C26H52O3Si2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]-3-hexyl-3-trimethylsilyloxetan-2-one |
| SMILES | CCCCCC[C@]1([Si](C)(C)C)C(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H52O3Si2/c1-10-11-12-16-19-26(30(5,6)7)23(28-24(26)27)20-22(21-17-14-13-15-18-21)29-31(8,9)25(2,3)4/h21-23H,10-20H2,1-9H3/t22-,23-,26+/m0/s1 |
| InChIKey | UFPNUYIFJYMMKH-JCYRPKCISA-N |
| XLogP | 8.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|