C19H40O3Si — CID 56591110
ethyl (4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyldecanoate (PubChem CID 56591110) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is ethyl (4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyldecanoate.
| Compound Name | ethyl (4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyldecanoate |
|---|---|
| PubChem CID | 56591110 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethyl (4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyldecanoate |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCC(=O)OCC |
| InChI | InChI=1S/C19H40O3Si/c1-9-11-12-13-17(22-23(7,8)19(4,5)6)16(3)14-15-18(20)21-10-2/h16-17H,9-15H2,1-8H3/t16-,17-/m0/s1 |
| InChIKey | NBRNODKBZLTDKE-IRXDYDNUSA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|