C20H40O5Si — CID 10620340
[(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-7-oxoheptyl] 2,2-dimethylpropanoate (PubChem CID 10620340) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is [(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-7-oxoheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-7-oxoheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10620340 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-7-oxoheptyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@H](CCOC(=O)C(C)(C)C)[C@H](C)[C@@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-15(16(23-8)12-14-24-18(22)19(2,3)4)17(11-13-21)25-26(9,10)20(5,6)7/h13,15-17H,11-12,14H2,1-10H3/t15-,16+,17+/m0/s1 |
| InChIKey | BKYMQRFFTAMNNH-GVDBMIGSSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|